C20H30O3 — CID 549712
ethyl 2-methyl-1-(7-methyl-3-methylideneoct-6-enyl)-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 549712) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is ethyl 2-methyl-1-(7-methyl-3-methylideneoct-6-enyl)-4-oxocyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl 2-methyl-1-(7-methyl-3-methylideneoct-6-enyl)-4-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 549712 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | ethyl 2-methyl-1-(7-methyl-3-methylideneoct-6-enyl)-4-oxocyclohex-2-ene-1-carboxylate |
| SMILES | C=C(CCC=C(C)C)CCC1(C(=O)OCC)CCC(=O)C=C1C |
| InChI | InChI=1S/C20H30O3/c1-6-23-19(22)20(13-11-18(21)14-17(20)5)12-10-16(4)9-7-8-15(2)3/h8,14H,4,6-7,9-13H2,1-3,5H3 |
| InChIKey | HDVFQMGEHVVJJB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|