C25H37FN4O3 — CID 118080601
(4-fluoro-3-methylphenyl) (3S)-4-acetyl-7-[1-amino-3-(cyclopropylamino)propan-2-yl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 118080601) has the molecular formula C25H37FN4O3 and a molecular weight of 460.59 g/mol. Its IUPAC name is (4-fluoro-3-methylphenyl) (3S)-4-acetyl-7-[1-amino-3-(cyclopropylamino)propan-2-yl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | (4-fluoro-3-methylphenyl) (3S)-4-acetyl-7-[1-amino-3-(cyclopropylamino)propan-2-yl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 118080601 |
| Molecular Formula | C25H37FN4O3 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | (4-fluoro-3-methylphenyl) (3S)-4-acetyl-7-[1-amino-3-(cyclopropylamino)propan-2-yl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C(CN)CNC3CC3)CC2N(C(=O)Oc2ccc(F)c(C)c2)C[C@@H]1C |
| InChI | InChI=1S/C25H37FN4O3/c1-15-10-21(7-8-22(15)26)33-25(32)29-14-16(2)30(17(3)31)23-9-4-18(11-24(23)29)19(12-27)13-28-20-5-6-20/h7-8,10,16,18-20,23-24,28H,4-6,9,11-14,27H2,1-3H3/t16-,18?,19?,23?,24?/m0/s1 |
| InChIKey | HPDRQYLPIMNDSK-PJTQRXAQSA-N |
| XLogP | 3.05 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |