C23H42N4O5 — CID 118080649
1-O-methyl 4-O-propan-2-yl (2S)-6-[1-amino-3-(oxan-4-ylamino)propan-2-yl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-dicarboxylate (PubChem CID 118080649) has the molecular formula C23H42N4O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 1-O-methyl 4-O-propan-2-yl (2S)-6-[1-amino-3-(oxan-4-ylamino)propan-2-yl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-dicarboxylate.
| Compound Name | 1-O-methyl 4-O-propan-2-yl (2S)-6-[1-amino-3-(oxan-4-ylamino)propan-2-yl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-dicarboxylate |
|---|---|
| PubChem CID | 118080649 |
| Molecular Formula | C23H42N4O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | 1-O-methyl 4-O-propan-2-yl (2S)-6-[1-amino-3-(oxan-4-ylamino)propan-2-yl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-dicarboxylate |
| SMILES | COC(=O)N1C2CCC(C(CN)CNC3CCOCC3)CC2N(C(=O)OC(C)C)C[C@@H]1C |
| InChI | InChI=1S/C23H42N4O5/c1-15(2)32-22(28)26-14-16(3)27(23(29)30-4)20-6-5-17(11-21(20)26)18(12-24)13-25-19-7-9-31-10-8-19/h15-21,25H,5-14,24H2,1-4H3/t16-,17?,18?,20?,21?/m0/s1 |
| InChIKey | AQPJLWJPTYYJGM-AENJHZEASA-N |
| XLogP | 2.18 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |