C22H40FN3O3 — CID 144846527
propan-2-yl (3S)-4-acetyl-7-[1-[2-fluoroethyl(methyl)amino]butan-2-yl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 144846527) has the molecular formula C22H40FN3O3 and a molecular weight of 413.58 g/mol. Its IUPAC name is propan-2-yl (3S)-4-acetyl-7-[1-[2-fluoroethyl(methyl)amino]butan-2-yl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | propan-2-yl (3S)-4-acetyl-7-[1-[2-fluoroethyl(methyl)amino]butan-2-yl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 144846527 |
| Molecular Formula | C22H40FN3O3 |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | propan-2-yl (3S)-4-acetyl-7-[1-[2-fluoroethyl(methyl)amino]butan-2-yl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CCC(CN(C)CCF)C1CCC2C(C1)N(C(=O)OC(C)C)C[C@H](C)N2C(C)=O |
| InChI | InChI=1S/C22H40FN3O3/c1-7-18(14-24(6)11-10-23)19-8-9-20-21(12-19)25(22(28)29-15(2)3)13-16(4)26(20)17(5)27/h15-16,18-21H,7-14H2,1-6H3/t16-,18?,19?,20?,21?/m0/s1 |
| InChIKey | QTHQJESMMBIZLW-DPYIETLKSA-N |
| XLogP | 3.55 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |