C22H37FN2O5S — CID 140685254
propan-2-yl (3S)-4-acetyl-7-(4-fluoro-3-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140685254) has the molecular formula C22H37FN2O5S and a molecular weight of 460.61 g/mol. Its IUPAC name is propan-2-yl (3S)-4-acetyl-7-(4-fluoro-3-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | propan-2-yl (3S)-4-acetyl-7-(4-fluoro-3-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140685254 |
| Molecular Formula | C22H37FN2O5S |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | propan-2-yl (3S)-4-acetyl-7-(4-fluoro-3-methylsulfonylcyclohexyl)-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCC(F)C(S(C)(=O)=O)C3)CC2N(C(=O)OC(C)C)C[C@@H]1C |
| InChI | InChI=1S/C22H37FN2O5S/c1-13(2)30-22(27)24-12-14(3)25(15(4)26)19-9-7-16(10-20(19)24)17-6-8-18(23)21(11-17)31(5,28)29/h13-14,16-21H,6-12H2,1-5H3/t14-,16?,17?,18?,19?,20?,21?/m0/s1 |
| InChIKey | PLYAMZZFQSHUHO-VOKXCIFESA-N |
| XLogP | 3.17 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |