C25H42N2O5S — CID 140684421
cyclohexyl (3S)-4-acetyl-3-methyl-7-(3-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684421) has the molecular formula C25H42N2O5S and a molecular weight of 482.69 g/mol. Its IUPAC name is cyclohexyl (3S)-4-acetyl-3-methyl-7-(3-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | cyclohexyl (3S)-4-acetyl-3-methyl-7-(3-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684421 |
| Molecular Formula | C25H42N2O5S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | cyclohexyl (3S)-4-acetyl-3-methyl-7-(3-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCCC(S(C)(=O)=O)C3)CC2N(C(=O)OC2CCCCC2)C[C@@H]1C |
| InChI | InChI=1S/C25H42N2O5S/c1-17-16-26(25(29)32-21-9-5-4-6-10-21)24-15-20(12-13-23(24)27(17)18(2)28)19-8-7-11-22(14-19)33(3,30)31/h17,19-24H,4-16H2,1-3H3/t17-,19?,20?,22?,23?,24?/m0/s1 |
| InChIKey | SGPZXFPVPCQXFA-VQCFPDCWSA-N |
| XLogP | 4.15 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |