C23H41N3O4S — CID 140737597
(3S)-4-acetyl-3-methyl-N-(2-methylpropyl)-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide (PubChem CID 140737597) has the molecular formula C23H41N3O4S and a molecular weight of 455.67 g/mol. Its IUPAC name is (3S)-4-acetyl-3-methyl-N-(2-methylpropyl)-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide.
| Compound Name | (3S)-4-acetyl-3-methyl-N-(2-methylpropyl)-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 140737597 |
| Molecular Formula | C23H41N3O4S |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | (3S)-4-acetyl-3-methyl-N-(2-methylpropyl)-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxamide |
| SMILES | CC(=O)N1C2CCC(C3CCC(S(C)(=O)=O)CC3)CC2N(C(=O)NCC(C)C)C[C@@H]1C |
| InChI | InChI=1S/C23H41N3O4S/c1-15(2)13-24-23(28)25-14-16(3)26(17(4)27)21-11-8-19(12-22(21)25)18-6-9-20(10-7-18)31(5,29)30/h15-16,18-22H,6-14H2,1-5H3,(H,24,28)/t16-,18?,19?,20?,21?,22?/m0/s1 |
| InChIKey | NOQKNNJEXFJIEB-LFWCDEDISA-N |
| XLogP | 3.05 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |