C29H48N2O5S — CID 140685185
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140685185) has the molecular formula C29H48N2O5S and a molecular weight of 536.78 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140685185 |
| Molecular Formula | C29H48N2O5S |
| Molecular Weight | 536.78 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCC(S(C)(=O)=O)CC3)CC2N(C(=O)OC2CCC3CCCCC3C2)C[C@@H]1C |
| InChI | InChI=1S/C29H48N2O5S/c1-19-18-30(29(33)36-25-12-8-21-6-4-5-7-23(21)16-25)28-17-24(11-15-27(28)31(19)20(2)32)22-9-13-26(14-10-22)37(3,34)35/h19,21-28H,4-18H2,1-3H3/t19-,21?,22?,23?,24?,25?,26?,27?,28?/m0/s1 |
| InChIKey | WYXIEFFMKWISTM-MLWGLLCKSA-N |
| XLogP | 5.18 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.78 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |