C23H40N4O5S — CID 140684700
ethyl (3S)-4-acetyl-3-methyl-7-(4-pyrazolidin-1-ylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684700) has the molecular formula C23H40N4O5S and a molecular weight of 484.66 g/mol. Its IUPAC name is ethyl (3S)-4-acetyl-3-methyl-7-(4-pyrazolidin-1-ylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | ethyl (3S)-4-acetyl-3-methyl-7-(4-pyrazolidin-1-ylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684700 |
| Molecular Formula | C23H40N4O5S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | ethyl (3S)-4-acetyl-3-methyl-7-(4-pyrazolidin-1-ylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CCOC(=O)N1C[C@H](C)N(C(C)=O)C2CCC(C3CCC(S(=O)(=O)N4CCCN4)CC3)CC21 |
| InChI | InChI=1S/C23H40N4O5S/c1-4-32-23(29)25-15-16(2)27(17(3)28)21-11-8-19(14-22(21)25)18-6-9-20(10-7-18)33(30,31)26-13-5-12-24-26/h16,18-22,24H,4-15H2,1-3H3/t16-,18?,19?,20?,21?,22?/m0/s1 |
| InChIKey | HZXLLZLYOTWKFV-LFWCDEDISA-N |
| XLogP | 2.33 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |