C22H36N2O6S — CID 140684788
oxetan-3-yl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684788) has the molecular formula C22H36N2O6S and a molecular weight of 456.61 g/mol. Its IUPAC name is oxetan-3-yl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | oxetan-3-yl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684788 |
| Molecular Formula | C22H36N2O6S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | oxetan-3-yl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCC(S(C)(=O)=O)CC3)CC2N(C(=O)OC2COC2)C[C@@H]1C |
| InChI | InChI=1S/C22H36N2O6S/c1-14-11-23(22(26)30-18-12-29-13-18)21-10-17(6-9-20(21)24(14)15(2)25)16-4-7-19(8-5-16)31(3,27)28/h14,16-21H,4-13H2,1-3H3/t14-,16?,17?,19?,20?,21?/m0/s1 |
| InChIKey | PULXLJZXZOSWOQ-UIWUOIOOSA-N |
| XLogP | 2.22 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |