C24H41N3O6S — CID 140684479
ethyl (3S)-4-acetyl-7-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 140684479) has the molecular formula C24H41N3O6S and a molecular weight of 499.67 g/mol. Its IUPAC name is ethyl (3S)-4-acetyl-7-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | ethyl (3S)-4-acetyl-7-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 140684479 |
| Molecular Formula | C24H41N3O6S |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | ethyl (3S)-4-acetyl-7-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxycyclohexyl]-3-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CCOC(=O)N1C[C@H](C)N(C(C)=O)C2CCC(C3CCC(OC)C(N4CCCS4(=O)=O)C3)CC21 |
| InChI | InChI=1S/C24H41N3O6S/c1-5-33-24(29)25-15-16(2)27(17(3)28)20-9-7-18(13-21(20)25)19-8-10-23(32-4)22(14-19)26-11-6-12-34(26,30)31/h16,18-23H,5-15H2,1-4H3/t16-,18?,19?,20?,21?,22?,23?/m0/s1 |
| InChIKey | CJOUDMIJAJJOEV-JUWQVUAISA-N |
| XLogP | 2.45 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |