C25H41N3O5S — CID 140685017
1-[(2S)-4-(cyclopropanecarbonyl)-6-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxycyclohexyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 140685017) has the molecular formula C25H41N3O5S and a molecular weight of 495.69 g/mol. Its IUPAC name is 1-[(2S)-4-(cyclopropanecarbonyl)-6-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxycyclohexyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-(cyclopropanecarbonyl)-6-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxycyclohexyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 140685017 |
| Molecular Formula | C25H41N3O5S |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 1-[(2S)-4-(cyclopropanecarbonyl)-6-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methoxycyclohexyl]-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | COC1CCC(C2CCC3C(C2)N(C(=O)C2CC2)C[C@H](C)N3C(C)=O)CC1N1CCCS1(=O)=O |
| InChI | InChI=1S/C25H41N3O5S/c1-16-15-26(25(30)18-5-6-18)22-13-19(7-9-21(22)28(16)17(2)29)20-8-10-24(33-3)23(14-20)27-11-4-12-34(27,31)32/h16,18-24H,4-15H2,1-3H3/t16-,19?,20?,21?,22?,23?,24?/m0/s1 |
| InChIKey | BHUGNEZDTHLYIP-RHJYHWIXSA-N |
| XLogP | 2.23 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |