C26H44N2O4S — CID 140685048
1-[(2S)-4-(cyclobutanecarbonyl)-2-methyl-6-[4-(2-methylpropylsulfonyl)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 140685048) has the molecular formula C26H44N2O4S and a molecular weight of 480.72 g/mol. Its IUPAC name is 1-[(2S)-4-(cyclobutanecarbonyl)-2-methyl-6-[4-(2-methylpropylsulfonyl)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-(cyclobutanecarbonyl)-2-methyl-6-[4-(2-methylpropylsulfonyl)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 140685048 |
| Molecular Formula | C26H44N2O4S |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | 1-[(2S)-4-(cyclobutanecarbonyl)-2-methyl-6-[4-(2-methylpropylsulfonyl)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | CC(=O)N1C2CCC(C3CCC(S(=O)(=O)CC(C)C)CC3)CC2N(C(=O)C2CCC2)C[C@@H]1C |
| InChI | InChI=1S/C26H44N2O4S/c1-17(2)16-33(31,32)23-11-8-20(9-12-23)22-10-13-24-25(14-22)27(26(30)21-6-5-7-21)15-18(3)28(24)19(4)29/h17-18,20-25H,5-16H2,1-4H3/t18-,20?,22?,23?,24?,25?/m0/s1 |
| InChIKey | BHIWGOAXWPJHSH-KMQBYFCJSA-N |
| XLogP | 4.03 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |