C22H39N3O6S — CID 140684924
1-O-methyl 4-O-propan-2-yl (2S)-2-methyl-6-[4-(sulfamoylmethyl)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-dicarboxylate (PubChem CID 140684924) has the molecular formula C22H39N3O6S and a molecular weight of 473.64 g/mol. Its IUPAC name is 1-O-methyl 4-O-propan-2-yl (2S)-2-methyl-6-[4-(sulfamoylmethyl)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-dicarboxylate.
| Compound Name | 1-O-methyl 4-O-propan-2-yl (2S)-2-methyl-6-[4-(sulfamoylmethyl)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-dicarboxylate |
|---|---|
| PubChem CID | 140684924 |
| Molecular Formula | C22H39N3O6S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 1-O-methyl 4-O-propan-2-yl (2S)-2-methyl-6-[4-(sulfamoylmethyl)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1,4-dicarboxylate |
| SMILES | COC(=O)N1C2CCC(C3CCC(CS(N)(=O)=O)CC3)CC2N(C(=O)OC(C)C)C[C@@H]1C |
| InChI | InChI=1S/C22H39N3O6S/c1-14(2)31-21(26)24-12-15(3)25(22(27)30-4)19-10-9-18(11-20(19)24)17-7-5-16(6-8-17)13-32(23,28)29/h14-20H,5-13H2,1-4H3,(H2,23,28,29)/t15-,16?,17?,18?,19?,20?/m0/s1 |
| InChIKey | QQPVGGPKUWCXIX-ZZRKNQPCSA-N |
| XLogP | 2.94 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |