C22H39N3O3 — CID 144846803
methyl 4-(1-cyclobutyloxyethenyl)-2-methyl-6-[1-(methylamino)butan-2-yl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 144846803) has the molecular formula C22H39N3O3 and a molecular weight of 393.57 g/mol. Its IUPAC name is methyl 4-(1-cyclobutyloxyethenyl)-2-methyl-6-[1-(methylamino)butan-2-yl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | methyl 4-(1-cyclobutyloxyethenyl)-2-methyl-6-[1-(methylamino)butan-2-yl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 144846803 |
| Molecular Formula | C22H39N3O3 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | methyl 4-(1-cyclobutyloxyethenyl)-2-methyl-6-[1-(methylamino)butan-2-yl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | C=C(OC1CCC1)N1CC(C)N(C(=O)OC)C2CCC(C(CC)CNC)CC21 |
| InChI | InChI=1S/C22H39N3O3/c1-6-17(13-23-4)18-10-11-20-21(12-18)24(16(3)28-19-8-7-9-19)14-15(2)25(20)22(26)27-5/h15,17-21,23H,3,6-14H2,1-2,4-5H3 |
| InChIKey | VRZKZLUTRIABEA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|