C18H35NO — CID 11808124
4-[(E)-2,2,5-trimethylundec-3-en-5-yl]morpholine (PubChem CID 11808124) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is 4-[(E)-2,2,5-trimethylundec-3-en-5-yl]morpholine.
| Compound Name | 4-[(E)-2,2,5-trimethylundec-3-en-5-yl]morpholine |
|---|---|
| PubChem CID | 11808124 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 4-[(E)-2,2,5-trimethylundec-3-en-5-yl]morpholine |
| SMILES | CCCCCCC(C)(/C=C/C(C)(C)C)N1CCOCC1 |
| InChI | InChI=1S/C18H35NO/c1-6-7-8-9-10-18(5,12-11-17(2,3)4)19-13-15-20-16-14-19/h11-12H,6-10,13-16H2,1-5H3/b12-11+ |
| InChIKey | ATJZIKAXMJILJT-VAWYXSNFSA-N |
| XLogP | 4.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|