C25H24F3N5O2 — CID 118084314
3-methyl-7-(4-methylimidazol-1-yl)-2-[[5-methyl-1-(2,2,2-trifluoroethyl)indol-3-yl]methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione (PubChem CID 118084314) has the molecular formula C25H24F3N5O2 and a molecular weight of 483.49 g/mol. Its IUPAC name is 3-methyl-7-(4-methylimidazol-1-yl)-2-[[5-methyl-1-(2,2,2-trifluoroethyl)indol-3-yl]methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione.
| Compound Name | 3-methyl-7-(4-methylimidazol-1-yl)-2-[[5-methyl-1-(2,2,2-trifluoroethyl)indol-3-yl]methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
|---|---|
| PubChem CID | 118084314 |
| Molecular Formula | C25H24F3N5O2 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-methyl-7-(4-methylimidazol-1-yl)-2-[[5-methyl-1-(2,2,2-trifluoroethyl)indol-3-yl]methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
| SMILES | Cc1ccc2c(c1)c(CN1C(=O)c3ccc(-n4cnc(C)c4)c(=O)n3CC1C)cn2CC(F)(F)F |
| InChI | InChI=1S/C25H24F3N5O2/c1-15-4-5-20-19(8-15)18(11-30(20)13-25(26,27)28)12-32-17(3)10-33-22(24(32)35)7-6-21(23(33)34)31-9-16(2)29-14-31/h4-9,11,14,17H,10,12-13H2,1-3H3 |
| InChIKey | KHMALRGZZSHIFG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |