About (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one
(E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one (PubChem CID 11808615) has the molecular formula C18H36OSi
and a molecular weight of 296.57 g/mol. Its IUPAC name is (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one |
| PubChem CID | 11808615 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one |
| SMILES | CC(=O)/C=C(\C)C(C)CC[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H36OSi/c1-13(2)20(14(3)4,15(5)6)11-10-16(7)17(8)12-18(9)19/h12-16H,10-11H2,1-9H3/b17-12+ |
| InChIKey | SDVXRIQDZDAZQT-SFQUDFHCSA-N |
| XLogP | 6.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one?
The IUPAC name of (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one (CID 11808615) is (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one.
What is the SMILES notation for (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one?
The canonical SMILES for (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one is CC(=O)/C=C(\C)C(C)CC[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one?
The InChIKey is SDVXRIQDZDAZQT-SFQUDFHCSA-N. The full InChI is InChI=1S/C18H36OSi/c1-13(2)20(14(3)4,15(5)6)11-10-16(7)17(8)12-18(9)19/h12-16H,10-11H2,1-9H3/b17-12+.
What are the key properties of (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one?
(E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one has a molecular weight of 296.57 g/mol, XLogP of 6.23, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,5-dimethyl-7-tri(propan-2-yl)silylhept-3-en-2-one is sourced from PubChem (CID 11808615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).