C20H32N2O4 — CID 118087757
heptyl 3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 118087757) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is heptyl 3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | heptyl 3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 118087757 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | heptyl 3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCCCCCCOC(=O)C1C2C=CC(O2)C1C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C20H32N2O4/c1-3-4-5-6-7-14-25-20(24)18-16-9-8-15(26-16)17(18)19(23)22-12-10-21(2)11-13-22/h8-9,15-18H,3-7,10-14H2,1-2H3 |
| InChIKey | NMRYOOWFRJOGRW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|