C15H27O4P — CID 11808819
[(3S,5S)-2,3-dimethyl-5-prop-1-en-2-ylcyclohexen-1-yl] diethyl phosphate (PubChem CID 11808819) has the molecular formula C15H27O4P and a molecular weight of 302.35 g/mol. Its IUPAC name is [(3S,5S)-2,3-dimethyl-5-prop-1-en-2-ylcyclohexen-1-yl] diethyl phosphate.
| Compound Name | [(3S,5S)-2,3-dimethyl-5-prop-1-en-2-ylcyclohexen-1-yl] diethyl phosphate |
|---|---|
| PubChem CID | 11808819 |
| Molecular Formula | C15H27O4P |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | [(3S,5S)-2,3-dimethyl-5-prop-1-en-2-ylcyclohexen-1-yl] diethyl phosphate |
| SMILES | C=C(C)[C@@H]1CC(OP(=O)(OCC)OCC)=C(C)[C@@H](C)C1 |
| InChI | InChI=1S/C15H27O4P/c1-7-17-20(16,18-8-2)19-15-10-14(11(3)4)9-12(5)13(15)6/h12,14H,3,7-10H2,1-2,4-6H3/t12-,14-/m0/s1 |
| InChIKey | CHZGVIGPYXPZOH-JSGCOSHPSA-N |
| XLogP | 5.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|