C14H25O4P — CID 139263397
[(1R,5R)-1-deuterio-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] diethyl phosphate (PubChem CID 139263397) has the molecular formula C14H25O4P and a molecular weight of 289.33 g/mol. Its IUPAC name is [(1R,5R)-1-deuterio-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] diethyl phosphate.
| Compound Name | [(1R,5R)-1-deuterio-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] diethyl phosphate |
|---|---|
| PubChem CID | 139263397 |
| Molecular Formula | C14H25O4P |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | [(1R,5R)-1-deuterio-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] diethyl phosphate |
| SMILES | [2H][C@@]1(OP(=O)(OCC)OCC)C[C@H](C(=C)C)CC=C1C |
| InChI | InChI=1S/C14H25O4P/c1-6-16-19(15,17-7-2)18-14-10-13(11(3)4)9-8-12(14)5/h8,13-14H,3,6-7,9-10H2,1-2,4-5H3/t13-,14-/m1/s1/i14D |
| InChIKey | XSKAVZBOSITEEW-TZRALSCDSA-N |
| XLogP | 4.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|