C32H42Cl2N4O7 — CID 118093493
3-[2,5-dichloro-4-[[(2S)-2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)pyrrolidin-1-yl]methyl]phenyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide (PubChem CID 118093493) has the molecular formula C32H42Cl2N4O7 and a molecular weight of 665.62 g/mol. Its IUPAC name is 3-[2,5-dichloro-4-[[(2S)-2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)pyrrolidin-1-yl]methyl]phenyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide.
| Compound Name | 3-[2,5-dichloro-4-[[(2S)-2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)pyrrolidin-1-yl]methyl]phenyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
|---|---|
| PubChem CID | 118093493 |
| Molecular Formula | C32H42Cl2N4O7 |
| Molecular Weight | 665.62 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | 3-[2,5-dichloro-4-[[(2S)-2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)pyrrolidin-1-yl]methyl]phenyl]-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]propanamide |
| SMILES | O=C(CCc1cc(Cl)c(CN2CCC[C@H]2C(=O)N2CCN(C3CC3)c3ccccc32)cc1Cl)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C32H42Cl2N4O7/c33-22-15-20(23(34)14-19(22)7-10-29(42)35-16-27(40)30(43)31(44)28(41)18-39)17-36-11-3-6-26(36)32(45)38-13-12-37(21-8-9-21)24-4-1-2-5-25(24)38/h1-2,4-5,14-15,21,26-28,30-31,39-41,43-44H,3,6-13,16-18H2,(H,35,42)/t26-,27-,28+,30+,31+/m0/s1 |
| InChIKey | HIIAUXJGSHQVAZ-XRXSYTHDSA-N |
| XLogP | 1.46 |
| TPSA | 157.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.62 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |