C33H44Cl2N4O7 — CID 123918384
3-[2,5-dichloro-4-[[2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)pyrrolidin-1-yl]methyl]phenyl]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)propanamide (PubChem CID 123918384) has the molecular formula C33H44Cl2N4O7 and a molecular weight of 679.64 g/mol. Its IUPAC name is 3-[2,5-dichloro-4-[[2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)pyrrolidin-1-yl]methyl]phenyl]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)propanamide.
| Compound Name | 3-[2,5-dichloro-4-[[2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)pyrrolidin-1-yl]methyl]phenyl]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)propanamide |
|---|---|
| PubChem CID | 123918384 |
| Molecular Formula | C33H44Cl2N4O7 |
| Molecular Weight | 679.64 g/mol |
| Exact Mass | 678.26 |
| IUPAC Name | 3-[2,5-dichloro-4-[[2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)pyrrolidin-1-yl]methyl]phenyl]-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)propanamide |
| SMILES | CN(CC(O)C(O)C(O)C(O)CO)C(=O)CCc1cc(Cl)c(CN2CCCC2C(=O)N2CCN(C3CC3)c3ccccc32)cc1Cl |
| InChI | InChI=1S/C33H44Cl2N4O7/c1-36(18-28(41)31(44)32(45)29(42)19-40)30(43)11-8-20-15-24(35)21(16-23(20)34)17-37-12-4-7-27(37)33(46)39-14-13-38(22-9-10-22)25-5-2-3-6-26(25)39/h2-3,5-6,15-16,22,27-29,31-32,40-42,44-45H,4,7-14,17-19H2,1H3 |
| InChIKey | RNVSAJLFOAOVAO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 148.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |