C29H22F2N4O6S — CID 118093843
4-[4-amino-2-(2,4-difluorophenoxy)-5-ethenyl-3-nitrophenyl]-6-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-c]pyridin-7-one (PubChem CID 118093843) has the molecular formula C29H22F2N4O6S and a molecular weight of 592.58 g/mol. Its IUPAC name is 4-[4-amino-2-(2,4-difluorophenoxy)-5-ethenyl-3-nitrophenyl]-6-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[4-amino-2-(2,4-difluorophenoxy)-5-ethenyl-3-nitrophenyl]-6-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 118093843 |
| Molecular Formula | C29H22F2N4O6S |
| Molecular Weight | 592.58 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | 4-[4-amino-2-(2,4-difluorophenoxy)-5-ethenyl-3-nitrophenyl]-6-methyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-c]pyridin-7-one |
| SMILES | C=Cc1cc(-c2cn(C)c(=O)c3c2ccn3S(=O)(=O)c2ccc(C)cc2)c(Oc2ccc(F)cc2F)c([N+](=O)[O-])c1N |
| InChI | InChI=1S/C29H22F2N4O6S/c1-4-17-13-21(28(27(25(17)32)35(37)38)41-24-10-7-18(30)14-23(24)31)22-15-33(3)29(36)26-20(22)11-12-34(26)42(39,40)19-8-5-16(2)6-9-19/h4-15H,1,32H2,2-3H3 |
| InChIKey | DCFOEDIHDCLAOO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|