C28H20F2N6O4S — CID 166477669
4-(6-fluoro-1-methylindol-3-yl)-N-(4-fluoro-3-nitrophenyl)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 166477669) has the molecular formula C28H20F2N6O4S and a molecular weight of 574.57 g/mol. Its IUPAC name is 4-(6-fluoro-1-methylindol-3-yl)-N-(4-fluoro-3-nitrophenyl)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(6-fluoro-1-methylindol-3-yl)-N-(4-fluoro-3-nitrophenyl)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 166477669 |
| Molecular Formula | C28H20F2N6O4S |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | 4-(6-fluoro-1-methylindol-3-yl)-N-(4-fluoro-3-nitrophenyl)-7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(-c4cn(C)c5cc(F)ccc45)nc(Nc4ccc(F)c([N+](=O)[O-])c4)nc32)cc1 |
| InChI | InChI=1S/C28H20F2N6O4S/c1-16-3-7-19(8-4-16)41(39,40)35-12-11-21-26(22-15-34(2)24-13-17(29)5-9-20(22)24)32-28(33-27(21)35)31-18-6-10-23(30)25(14-18)36(37)38/h3-15H,1-2H3,(H,31,32,33) |
| InChIKey | HBWHFNFXGKCOFL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|