C21H12F3IN6O2S — CID 166477776
[4-(5,6-difluoro-1-methylindol-3-yl)-2-(4-fluoro-3-nitroanilino)pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite (PubChem CID 166477776) has the molecular formula C21H12F3IN6O2S and a molecular weight of 596.33 g/mol. Its IUPAC name is [4-(5,6-difluoro-1-methylindol-3-yl)-2-(4-fluoro-3-nitroanilino)pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite.
| Compound Name | [4-(5,6-difluoro-1-methylindol-3-yl)-2-(4-fluoro-3-nitroanilino)pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite |
|---|---|
| PubChem CID | 166477776 |
| Molecular Formula | C21H12F3IN6O2S |
| Molecular Weight | 596.33 g/mol |
| Exact Mass | 595.97 |
| IUPAC Name | [4-(5,6-difluoro-1-methylindol-3-yl)-2-(4-fluoro-3-nitroanilino)pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite |
| SMILES | Cn1cc(-c2nc(Nc3ccc(F)c([N+](=O)[O-])c3)nc3c2ccn3SI)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C21H12F3IN6O2S/c1-29-9-13(12-7-15(23)16(24)8-17(12)29)19-11-4-5-30(34-25)20(11)28-21(27-19)26-10-2-3-14(22)18(6-10)31(32)33/h2-9H,1H3,(H,26,27,28) |
| InChIKey | KKQCSOKCLRGTEA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.33 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|