C15H9ClFIN4S — CID 166477397
[2-chloro-4-(5-fluoro-1-methylindol-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite (PubChem CID 166477397) has the molecular formula C15H9ClFIN4S and a molecular weight of 458.69 g/mol. Its IUPAC name is [2-chloro-4-(5-fluoro-1-methylindol-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite.
| Compound Name | [2-chloro-4-(5-fluoro-1-methylindol-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite |
|---|---|
| PubChem CID | 166477397 |
| Molecular Formula | C15H9ClFIN4S |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 457.93 |
| IUPAC Name | [2-chloro-4-(5-fluoro-1-methylindol-3-yl)pyrrolo[2,3-d]pyrimidin-7-yl] thiohypoiodite |
| SMILES | Cn1cc(-c2nc(Cl)nc3c2ccn3SI)c2cc(F)ccc21 |
| InChI | InChI=1S/C15H9ClFIN4S/c1-21-7-11(10-6-8(17)2-3-12(10)21)13-9-4-5-22(23-18)14(9)20-15(16)19-13/h2-7H,1H3 |
| InChIKey | CLVAYSZTGOACML-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|