C19H15F2N5O2 — CID 118095026
N-[4-(difluoromethoxy)phenyl]-6-(2-methylbenzimidazol-1-yl)-4-oxidopyrazin-4-ium-2-amine (PubChem CID 118095026) has the molecular formula C19H15F2N5O2 and a molecular weight of 383.36 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-6-(2-methylbenzimidazol-1-yl)-4-oxidopyrazin-4-ium-2-amine.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-6-(2-methylbenzimidazol-1-yl)-4-oxidopyrazin-4-ium-2-amine |
|---|---|
| PubChem CID | 118095026 |
| Molecular Formula | C19H15F2N5O2 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-6-(2-methylbenzimidazol-1-yl)-4-oxidopyrazin-4-ium-2-amine |
| SMILES | Cc1nc2ccccc2n1-c1c[n+]([O-])cc(Nc2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C19H15F2N5O2/c1-12-22-15-4-2-3-5-16(15)26(12)18-11-25(27)10-17(24-18)23-13-6-8-14(9-7-13)28-19(20)21/h2-11,19H,1H3,(H,23,24) |
| InChIKey | CYEASYONUGKSOZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|