C9H14N+ — CID 118097718
1,2,3,5-tetramethyl-4-methylidenepyrrol-1-ium (PubChem CID 118097718) has the molecular formula C9H14N+ and a molecular weight of 136.22 g/mol. Its IUPAC name is 1,2,3,5-tetramethyl-4-methylidenepyrrol-1-ium.
| Compound Name | 1,2,3,5-tetramethyl-4-methylidenepyrrol-1-ium |
|---|---|
| PubChem CID | 118097718 |
| Molecular Formula | C9H14N+ |
| Molecular Weight | 136.22 g/mol |
| Exact Mass | 136.11 |
| IUPAC Name | 1,2,3,5-tetramethyl-4-methylidenepyrrol-1-ium |
| SMILES | C=C1C(C)=C(C)[N+](C)=C1C |
| InChI | InChI=1S/C9H14N/c1-6-7(2)9(4)10(5)8(6)3/h1H2,2-5H3/q+1 |
| InChIKey | QFSWJXUDMQNTLQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|