C10H15N — CID 21022302
1,3,4,5,6-pentamethyl-2H-pyridin-1-ium-2-ide (PubChem CID 21022302) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 1,3,4,5,6-pentamethyl-2H-pyridin-1-ium-2-ide.
| Compound Name | 1,3,4,5,6-pentamethyl-2H-pyridin-1-ium-2-ide |
|---|---|
| PubChem CID | 21022302 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1,3,4,5,6-pentamethyl-2H-pyridin-1-ium-2-ide |
| SMILES | Cc1[c-][n+](C)c(C)c(C)c1C |
| InChI | InChI=1S/C10H15N/c1-7-6-11(5)10(4)9(3)8(7)2/h1-5H3 |
| InChIKey | NPMKDQGXGGZMMD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|