C11H16N+ — CID 101015672
dimethyl-(4-propan-2-ylidenecyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 101015672) has the molecular formula C11H16N+ and a molecular weight of 162.26 g/mol. Its IUPAC name is dimethyl-(4-propan-2-ylidenecyclohexa-2,5-dien-1-ylidene)azanium.
| Compound Name | dimethyl-(4-propan-2-ylidenecyclohexa-2,5-dien-1-ylidene)azanium |
|---|---|
| PubChem CID | 101015672 |
| Molecular Formula | C11H16N+ |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | dimethyl-(4-propan-2-ylidenecyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | CC(C)=C1C=CC(=[N+](C)C)C=C1 |
| InChI | InChI=1S/C11H16N/c1-9(2)10-5-7-11(8-6-10)12(3)4/h5-8H,1-4H3/q+1 |
| InChIKey | GXFROYRCQIRDIJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|