C15H16ClNO4 — CID 10979801
(4-cyclohepta-2,4,6-trien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium perchlorate (PubChem CID 10979801) has the molecular formula C15H16ClNO4 and a molecular weight of 309.75 g/mol. Its IUPAC name is (4-cyclohepta-2,4,6-trien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium perchlorate.
| Compound Name | (4-cyclohepta-2,4,6-trien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 10979801 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | (4-cyclohepta-2,4,6-trien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium perchlorate |
| SMILES | C[N+](C)=C1C=CC(=C2C=CC=CC=C2)C=C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C15H16N.ClHO4/c1-16(2)15-11-9-14(10-12-15)13-7-5-3-4-6-8-13;2-1(3,4)5/h3-12H,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HYCZPOASQNQHHP-UHFFFAOYSA-M |
| XLogP | -1.95 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|