C10H14N+ — CID 123872429
dimethyl-(3-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 123872429) has the molecular formula C10H14N+ and a molecular weight of 148.23 g/mol. Its IUPAC name is dimethyl-(3-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium.
| Compound Name | dimethyl-(3-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium |
|---|---|
| PubChem CID | 123872429 |
| Molecular Formula | C10H14N+ |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | dimethyl-(3-methyl-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | C=C1C=CC(=[N+](C)C)C=C1C |
| InChI | InChI=1S/C10H14N/c1-8-5-6-10(11(3)4)7-9(8)2/h5-7H,1H2,2-4H3/q+1 |
| InChIKey | SOYPQHZZXBGYNQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|