C18H16N+ — CID 154707776
dimethyl-[(6Z)-6-naphthalen-1-ylidenecyclohexa-2,4-dien-1-ylidene]azanium (PubChem CID 154707776) has the molecular formula C18H16N+ and a molecular weight of 246.33 g/mol. Its IUPAC name is dimethyl-[(6Z)-6-naphthalen-1-ylidenecyclohexa-2,4-dien-1-ylidene]azanium.
| Compound Name | dimethyl-[(6Z)-6-naphthalen-1-ylidenecyclohexa-2,4-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 154707776 |
| Molecular Formula | C18H16N+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | dimethyl-[(6Z)-6-naphthalen-1-ylidenecyclohexa-2,4-dien-1-ylidene]azanium |
| SMILES | C[N+](C)=C1C=CC=C/C1=c1\cccc2c1=C=CC=C2 |
| InChI | InChI=1S/C18H16N/c1-19(2)18-13-6-5-11-17(18)16-12-7-9-14-8-3-4-10-15(14)16/h3-9,11-13H,1-2H3/q+1/b17-16- |
| InChIKey | AQBUQFWIUXQOHH-MSUUIHNZSA-N |
| XLogP | 1.64 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|