C21H24N3Y- — CID 58689975
N,N-dimethyl-4-[(1,2,2,4-tetramethyl-7H-quinolin-1-ium-7-id-6-ylidene)amino]benzene-5-id-1-amine;yttrium (PubChem CID 58689975) has the molecular formula C21H24N3Y- and a molecular weight of 407.35 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1,2,2,4-tetramethyl-7H-quinolin-1-ium-7-id-6-ylidene)amino]benzene-5-id-1-amine;yttrium.
| Compound Name | N,N-dimethyl-4-[(1,2,2,4-tetramethyl-7H-quinolin-1-ium-7-id-6-ylidene)amino]benzene-5-id-1-amine;yttrium |
|---|---|
| PubChem CID | 58689975 |
| Molecular Formula | C21H24N3Y- |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N,N-dimethyl-4-[(1,2,2,4-tetramethyl-7H-quinolin-1-ium-7-id-6-ylidene)amino]benzene-5-id-1-amine;yttrium |
| SMILES | CC1=CC(C)(C)[N+](C)=C2C=[C-]/C(=N\c3[c-]cc(N(C)C)cc3)C=C12.[Y] |
| InChI | InChI=1S/C21H24N3.Y/c1-15-14-21(2,3)24(6)20-12-9-17(13-19(15)20)22-16-7-10-18(11-8-16)23(4)5;/h7,10-14H,1-6H3;/q-1; |
| InChIKey | PKQADEMYLAKHTD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 18.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|