C16H18N2 — CID 142881746
N-ethyl-N-methyl-2,3-dihydroacridin-9-amine (PubChem CID 142881746) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-ethyl-N-methyl-2,3-dihydroacridin-9-amine.
| Compound Name | N-ethyl-N-methyl-2,3-dihydroacridin-9-amine |
|---|---|
| PubChem CID | 142881746 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-ethyl-N-methyl-2,3-dihydroacridin-9-amine |
| SMILES | CCN(C)c1c2c(nc3ccccc13)=CCCC=2 |
| InChI | InChI=1S/C16H18N2/c1-3-18(2)16-12-8-4-6-10-14(12)17-15-11-7-5-9-13(15)16/h4,6,8-11H,3,5,7H2,1-2H3 |
| InChIKey | CMAYLZAYYHIFMM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |