C17H19N2Y- — CID 147624870
[4-[[4-(dimethylamino)benzene-6-id-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;yttrium (PubChem CID 147624870) has the molecular formula C17H19N2Y- and a molecular weight of 340.26 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)benzene-6-id-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;yttrium.
| Compound Name | [4-[[4-(dimethylamino)benzene-6-id-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;yttrium |
|---|---|
| PubChem CID | 147624870 |
| Molecular Formula | C17H19N2Y- |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | [4-[[4-(dimethylamino)benzene-6-id-1-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;yttrium |
| SMILES | CN(C)c1c[c-]c(C=C2[C-]=CC(=[N+](C)C)C=C2)cc1.[Y] |
| InChI | InChI=1S/C17H19N2.Y/c1-18(2)16-9-5-14(6-10-16)13-15-7-11-17(12-8-15)19(3)4;/h5,7,9-13H,1-4H3;/q-1; |
| InChIKey | IQPWJBPXTSICND-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|