C13H20N+ — CID 144659210
1,2-dimethyl-6,7-dihydroquinolin-1-ium;ethane (PubChem CID 144659210) has the molecular formula C13H20N+ and a molecular weight of 190.31 g/mol. Its IUPAC name is 1,2-dimethyl-6,7-dihydroquinolin-1-ium;ethane.
| Compound Name | 1,2-dimethyl-6,7-dihydroquinolin-1-ium;ethane |
|---|---|
| PubChem CID | 144659210 |
| Molecular Formula | C13H20N+ |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 1,2-dimethyl-6,7-dihydroquinolin-1-ium;ethane |
| SMILES | CC.Cc1ccc2c([n+]1C)=CCCC=2 |
| InChI | InChI=1S/C11H14N.C2H6/c1-9-7-8-10-5-3-4-6-11(10)12(9)2;1-2/h5-8H,3-4H2,1-2H3;1-2H3/q+1; |
| InChIKey | KVVDANMBCZNHOP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|