C17H21N2+ — CID 176537705
[4-[[4-(dimethylamino)cyclohexa-2,4-dien-1-ylidene]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 176537705) has the molecular formula C17H21N2+ and a molecular weight of 253.37 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)cyclohexa-2,4-dien-1-ylidene]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[[4-(dimethylamino)cyclohexa-2,4-dien-1-ylidene]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 176537705 |
| Molecular Formula | C17H21N2+ |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | [4-[[4-(dimethylamino)cyclohexa-2,4-dien-1-ylidene]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CN(C)C1=CCC(=C=C2C=CC(=[N+](C)C)C=C2)C=C1 |
| InChI | InChI=1S/C17H21N2/c1-18(2)16-9-5-14(6-10-16)13-15-7-11-17(12-8-15)19(3)4/h5-7,9-12H,8H2,1-4H3/q+1 |
| InChIKey | UCIQMOWJSYPXHF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|