C17H12N2 — CID 54254997
9,19-diazatetracyclo[10.7.0.04,9.013,18]nonadeca-1,3,5,7,10,12,14,16,18-nonaene (PubChem CID 54254997) has the molecular formula C17H12N2 and a molecular weight of 244.30 g/mol. Its IUPAC name is 9,19-diazatetracyclo[10.7.0.04,9.013,18]nonadeca-1,3,5,7,10,12,14,16,18-nonaene.
| Compound Name | 9,19-diazatetracyclo[10.7.0.04,9.013,18]nonadeca-1,3,5,7,10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 54254997 |
| Molecular Formula | C17H12N2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 9,19-diazatetracyclo[10.7.0.04,9.013,18]nonadeca-1,3,5,7,10,12,14,16,18-nonaene |
| SMILES | C1=CC2=CC=C3N=c4ccccc4=C3C=CN2C=C1 |
| InChI | InChI=1S/C17H12N2/c1-2-7-16-14(6-1)15-10-12-19-11-4-3-5-13(19)8-9-17(15)18-16/h1-12H |
| InChIKey | QZJXNDFZTGJXND-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |