C14H11NU — CID 58833585
N-methyl-1,1-di(phenyl)methanimine;uranium(2+) (PubChem CID 58833585) has the molecular formula C14H11NU and a molecular weight of 431.28 g/mol. Its IUPAC name is N-methyl-1,1-di(phenyl)methanimine;uranium(2+).
| Compound Name | N-methyl-1,1-di(phenyl)methanimine;uranium(2+) |
|---|---|
| PubChem CID | 58833585 |
| Molecular Formula | C14H11NU |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-methyl-1,1-di(phenyl)methanimine;uranium(2+) |
| SMILES | CN=C(c1[c-]cccc1)c1[c-]cccc1.[U+2] |
| InChI | InChI=1S/C14H11N.U/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;/h2-8,10H,1H3;/q-2;+2 |
| InChIKey | LSETUZKNCGAXMX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|