C13H16ClN — CID 159522972
dimethyl-(4-penta-2,4-dienylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride (PubChem CID 159522972) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is dimethyl-(4-penta-2,4-dienylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride.
| Compound Name | dimethyl-(4-penta-2,4-dienylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride |
|---|---|
| PubChem CID | 159522972 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | dimethyl-(4-penta-2,4-dienylidenecyclohexa-2,5-dien-1-ylidene)azanium chloride |
| SMILES | C=CC=CC=C1C=CC(=[N+](C)C)C=C1.[Cl-] |
| InChI | InChI=1S/C13H16N.ClH/c1-4-5-6-7-12-8-10-13(11-9-12)14(2)3;/h4-11H,1H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | MCAPROXRQKAKJZ-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|