C9H16N+ — CID 123949741
dimethyl(4-methylhexa-3,5-dien-2-ylidene)azanium (PubChem CID 123949741) has the molecular formula C9H16N+ and a molecular weight of 138.23 g/mol. Its IUPAC name is dimethyl(4-methylhexa-3,5-dien-2-ylidene)azanium.
| Compound Name | dimethyl(4-methylhexa-3,5-dien-2-ylidene)azanium |
|---|---|
| PubChem CID | 123949741 |
| Molecular Formula | C9H16N+ |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | dimethyl(4-methylhexa-3,5-dien-2-ylidene)azanium |
| SMILES | C=CC(C)=CC(C)=[N+](C)C |
| InChI | InChI=1S/C9H16N/c1-6-8(2)7-9(3)10(4)5/h6-7H,1H2,2-5H3/q+1 |
| InChIKey | YVTZDSYVUBJSGA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|