C15H20FN — CID 178135533
(3Z,5E)-N-[(3E)-3-fluoro-5-methyl-2-methylidenehexa-3,5-dienyl]hepta-3,5-dien-2-imine (PubChem CID 178135533) has the molecular formula C15H20FN and a molecular weight of 233.33 g/mol. Its IUPAC name is (3Z,5E)-N-[(3E)-3-fluoro-5-methyl-2-methylidenehexa-3,5-dienyl]hepta-3,5-dien-2-imine.
| Compound Name | (3Z,5E)-N-[(3E)-3-fluoro-5-methyl-2-methylidenehexa-3,5-dienyl]hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 178135533 |
| Molecular Formula | C15H20FN |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (3Z,5E)-N-[(3E)-3-fluoro-5-methyl-2-methylidenehexa-3,5-dienyl]hepta-3,5-dien-2-imine |
| SMILES | C=C(C)/C=C(/F)C(=C)C/N=C(C)/C=C\C=C\C |
| InChI | InChI=1S/C15H20FN/c1-6-7-8-9-14(5)17-11-13(4)15(16)10-12(2)3/h6-10H,2,4,11H2,1,3,5H3/b7-6+,9-8-,15-10+,17-14+ |
| InChIKey | YFLZJIFALITYGD-RNXZLZORSA-N |
| XLogP | 4.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|