C10H15NY-2 — CID 58651170
carbanide;2,3,5,6-tetramethyl-4H-pyridin-4-ide;yttrium (PubChem CID 58651170) has the molecular formula C10H15NY-2 and a molecular weight of 238.14 g/mol. Its IUPAC name is carbanide;2,3,5,6-tetramethyl-4H-pyridin-4-ide;yttrium.
| Compound Name | carbanide;2,3,5,6-tetramethyl-4H-pyridin-4-ide;yttrium |
|---|---|
| PubChem CID | 58651170 |
| Molecular Formula | C10H15NY-2 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | carbanide;2,3,5,6-tetramethyl-4H-pyridin-4-ide;yttrium |
| SMILES | Cc1[c-]c(C)c(C)nc1C.[CH3-].[Y] |
| InChI | InChI=1S/C9H12N.CH3.Y/c1-6-5-7(2)9(4)10-8(6)3;;/h1-4H3;1H3;/q2*-1; |
| InChIKey | MKFXBEFWBHPRSJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|