C9H12NY- — CID 59117714
3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium (PubChem CID 59117714) has the molecular formula C9H12NY- and a molecular weight of 223.11 g/mol. Its IUPAC name is 3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium.
| Compound Name | 3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium |
|---|---|
| PubChem CID | 59117714 |
| Molecular Formula | C9H12NY- |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium |
| SMILES | Cc1[c-]nc(C)c(C)c1C.[Y] |
| InChI | InChI=1S/C9H12N.Y/c1-6-5-10-9(4)8(3)7(6)2;/h1-4H3;/q-1; |
| InChIKey | JQQLXKQTSOKIMH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|