C7H8NY2- — CID 59840880
4,6-dimethyl-2H-pyridin-2-ide;bis(yttrium) (PubChem CID 59840880) has the molecular formula C7H8NY2- and a molecular weight of 283.96 g/mol. Its IUPAC name is 4,6-dimethyl-2H-pyridin-2-ide;bis(yttrium).
| Compound Name | 4,6-dimethyl-2H-pyridin-2-ide;bis(yttrium) |
|---|---|
| PubChem CID | 59840880 |
| Molecular Formula | C7H8NY2- |
| Molecular Weight | 283.96 g/mol |
| Exact Mass | 283.88 |
| IUPAC Name | 4,6-dimethyl-2H-pyridin-2-ide;bis(yttrium) |
| SMILES | Cc1c[c-]nc(C)c1.[Y].[Y] |
| InChI | InChI=1S/C7H8N.2Y/c1-6-3-4-8-7(2)5-6;;/h3,5H,1-2H3;;/q-1;; |
| InChIKey | DQBKNXHRMSYFGY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.96 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|