About carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium
carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium (PubChem CID 58651183) has the molecular formula C10H15NY-2
and a molecular weight of 238.14 g/mol. Its IUPAC name is carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium.
Molecular Properties
| Compound Name | carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium |
| PubChem CID | 58651183 |
| Molecular Formula | C10H15NY-2 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium |
| SMILES | Cc1[c-]c(C)c(C)c(C)n1.[CH3-].[Y] |
| InChI | InChI=1S/C9H12N.CH3.Y/c1-6-5-7(2)10-9(4)8(6)3;;/h1-4H3;1H3;/q2*-1; |
| InChIKey | SRAIFBDGDIGHQX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium?
The IUPAC name of carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium (CID 58651183) is carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium.
What is the SMILES notation for carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium?
The canonical SMILES for carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium is Cc1[c-]c(C)c(C)c(C)n1.[CH3-].[Y].
What is the InChIKey of carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium?
The InChIKey is SRAIFBDGDIGHQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.CH3.Y/c1-6-5-7(2)10-9(4)8(6)3;;/h1-4H3;1H3;/q2*-1;.
What are the key properties of carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium?
carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium has a molecular weight of 238.14 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2,4,5,6-tetramethyl-3H-pyridin-3-ide;yttrium is sourced from PubChem (CID 58651183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).