C9H9N2Y- — CID 59297075
3,4,6-trimethyl-2H-pyridin-2-ide-5-carbonitrile;yttrium (PubChem CID 59297075) has the molecular formula C9H9N2Y- and a molecular weight of 234.09 g/mol. Its IUPAC name is 3,4,6-trimethyl-2H-pyridin-2-ide-5-carbonitrile;yttrium.
| Compound Name | 3,4,6-trimethyl-2H-pyridin-2-ide-5-carbonitrile;yttrium |
|---|---|
| PubChem CID | 59297075 |
| Molecular Formula | C9H9N2Y- |
| Molecular Weight | 234.09 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | 3,4,6-trimethyl-2H-pyridin-2-ide-5-carbonitrile;yttrium |
| SMILES | Cc1[c-]nc(C)c(C#N)c1C.[Y] |
| InChI | InChI=1S/C9H9N2.Y/c1-6-5-11-8(3)9(4-10)7(6)2;/h1-3H3;/q-1; |
| InChIKey | NHXNKRZNMJUPIA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.09 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|