C10H15NY+ — CID 20740581
carbanide;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium(3+) (PubChem CID 20740581) has the molecular formula C10H15NY+ and a molecular weight of 238.14 g/mol. Its IUPAC name is carbanide;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium(3+).
| Compound Name | carbanide;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium(3+) |
|---|---|
| PubChem CID | 20740581 |
| Molecular Formula | C10H15NY+ |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | carbanide;3,4,5,6-tetramethyl-2H-pyridin-2-ide;yttrium(3+) |
| SMILES | Cc1[c-]nc(C)c(C)c1C.[CH3-].[Y+3] |
| InChI | InChI=1S/C9H12N.CH3.Y/c1-6-5-10-9(4)8(3)7(6)2;;/h1-4H3;1H3;/q2*-1;+3 |
| InChIKey | OJENSCIFLZTCBU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|